C25H35N9O8 — CID 18246962
3-amino-4-[[1-[[4-amino-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1,4-dioxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18246962) has the molecular formula C25H35N9O8 and a molecular weight of 589.61 g/mol. Its IUPAC name is 3-amino-4-[[1-[[4-amino-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1,4-dioxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[4-amino-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1,4-dioxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18246962 |
| Molecular Formula | C25H35N9O8 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 3-amino-4-[[1-[[4-amino-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1,4-dioxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H35N9O8/c26-14(9-20(36)37)21(38)32-16(6-3-7-30-25(28)29)22(39)33-17(10-19(27)35)23(40)34-18(24(41)42)8-12-11-31-15-5-2-1-4-13(12)15/h1-2,4-5,11,14,16-18,31H,3,6-10,26H2,(H2,27,35)(H,32,38)(H,33,39)(H,34,40)(H,36,37)(H,41,42)(H4,28,29,30) |
| InChIKey | YIDWPPMZFSZNAY-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 311.20 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|