C27H42N12O6 — CID 19942867
2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19942867) has the molecular formula C27H42N12O6 and a molecular weight of 630.71 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19942867 |
| Molecular Formula | C27H42N12O6 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H42N12O6/c28-16(11-14-13-36-17-6-2-1-5-15(14)17)22(41)39-20(12-21(29)40)24(43)37-18(7-3-9-34-26(30)31)23(42)38-19(25(44)45)8-4-10-35-27(32)33/h1-2,5-6,13,16,18-20,36H,3-4,7-12,28H2,(H2,29,40)(H,37,43)(H,38,42)(H,39,41)(H,44,45)(H4,30,31,34)(H4,32,33,35) |
| InChIKey | JRHUWRPSHJYJRU-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 338.30 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|