C26H39N9O6 — CID 19942885
2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid (PubChem CID 19942885) has the molecular formula C26H39N9O6 and a molecular weight of 573.66 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19942885 |
| Molecular Formula | C26H39N9O6 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H39N9O6/c1-13(2)21(25(40)41)35-23(38)18(8-5-9-31-26(29)30)33-24(39)19(11-20(28)36)34-22(37)16(27)10-14-12-32-17-7-4-3-6-15(14)17/h3-4,6-7,12-13,16,18-19,21,32H,5,8-11,27H2,1-2H3,(H2,28,36)(H,33,39)(H,34,37)(H,35,38)(H,40,41)(H4,29,30,31) |
| InChIKey | VKROMFSRRVCFCH-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 273.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|