C27H40N8O7 — CID 18242866
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242866) has the molecular formula C27H40N8O7 and a molecular weight of 588.67 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242866 |
| Molecular Formula | C27H40N8O7 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H40N8O7/c1-14(2)22(26(41)42)35-25(40)20(12-15-13-32-18-8-4-3-6-16(15)18)34-24(39)19(9-10-21(36)37)33-23(38)17(28)7-5-11-31-27(29)30/h3-4,6,8,13-14,17,19-20,22,32H,5,7,9-12,28H2,1-2H3,(H,33,38)(H,34,39)(H,35,40)(H,36,37)(H,41,42)(H4,29,30,31) |
| InChIKey | KGTOEICGJHXSHV-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|