C28H45N9O5 — CID 22651125
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoic acid (PubChem CID 22651125) has the molecular formula C28H45N9O5 and a molecular weight of 587.73 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22651125 |
| Molecular Formula | C28H45N9O5 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C28H45N9O5/c1-16(2)23(27(41)42)37-25(39)21(11-5-6-12-29)35-26(40)22(14-17-15-34-20-10-4-3-8-18(17)20)36-24(38)19(30)9-7-13-33-28(31)32/h3-4,8,10,15-16,19,21-23,34H,5-7,9,11-14,29-30H2,1-2H3,(H,35,40)(H,36,38)(H,37,39)(H,41,42)(H4,31,32,33) |
| InChIKey | FHXSCUOEUGFBMP-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 256.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|