C28H45N11O5 — CID 18241268
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 18241268) has the molecular formula C28H45N11O5 and a molecular weight of 615.74 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18241268 |
| Molecular Formula | C28H45N11O5 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.36 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C28H45N11O5/c1-15(2)22(26(43)44)39-25(42)21(13-16-14-36-19-9-4-3-7-17(16)19)38-24(41)20(10-6-12-35-28(32)33)37-23(40)18(29)8-5-11-34-27(30)31/h3-4,7,9,14-15,18,20-22,36H,5-6,8,10-13,29H2,1-2H3,(H,37,40)(H,38,41)(H,39,42)(H,43,44)(H4,30,31,34)(H4,32,33,35) |
| InChIKey | GAXDTSCMYNZNHY-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 295.21 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|