C25H38N8O7 — CID 22651221
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22651221) has the molecular formula C25H38N8O7 and a molecular weight of 562.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22651221 |
| Molecular Formula | C25H38N8O7 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(C)O)C(=O)O |
| InChI | InChI=1S/C25H38N8O7/c1-12(34)19(23(38)33-20(13(2)35)24(39)40)32-22(37)18(10-14-11-30-17-8-4-3-6-15(14)17)31-21(36)16(26)7-5-9-29-25(27)28/h3-4,6,8,11-13,16,18-20,30,34-35H,5,7,9-10,26H2,1-2H3,(H,31,36)(H,32,37)(H,33,38)(H,39,40)(H4,27,28,29) |
| InChIKey | GHYAYMAXPCGBKJ-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 271.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|