C24H36N8O6 — CID 18239270
2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18239270) has the molecular formula C24H36N8O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18239270 |
| Molecular Formula | C24H36N8O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)O |
| InChI | InChI=1S/C24H36N8O6/c1-12(25)20(34)32-19(13(2)33)22(36)31-18(10-14-11-29-16-7-4-3-6-15(14)16)21(35)30-17(23(37)38)8-5-9-28-24(26)27/h3-4,6-7,11-13,17-19,29,33H,5,8-10,25H2,1-2H3,(H,30,35)(H,31,36)(H,32,34)(H,37,38)(H4,26,27,28) |
| InChIKey | VHQUKGDZIOEWGB-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 251.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|