C32H41N9O6 — CID 22650847
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22650847) has the molecular formula C32H41N9O6 and a molecular weight of 647.74 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22650847 |
| Molecular Formula | C32H41N9O6 |
| Molecular Weight | 647.74 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C32H41N9O6/c1-17(42)27(41-28(43)22(33)9-6-12-36-32(34)35)30(45)39-25(13-18-15-37-23-10-4-2-7-20(18)23)29(44)40-26(31(46)47)14-19-16-38-24-11-5-3-8-21(19)24/h2-5,7-8,10-11,15-17,22,25-27,37-38,42H,6,9,12-14,33H2,1H3,(H,39,45)(H,40,44)(H,41,43)(H,46,47)(H4,34,35,36) |
| InChIKey | FIWRVUMKNSSBPC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 266.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.74 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|