C22H33N7O4 — CID 18218966
2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18218966) has the molecular formula C22H33N7O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18218966 |
| Molecular Formula | C22H33N7O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H33N7O4/c1-12(2)18(29-19(30)15(23)7-5-9-26-22(24)25)20(31)28-17(21(32)33)10-13-11-27-16-8-4-3-6-14(13)16/h3-4,6,8,11-12,15,17-18,27H,5,7,9-10,23H2,1-2H3,(H,28,31)(H,29,30)(H,32,33)(H4,24,25,26) |
| InChIKey | UTSMXMABBPFVJP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 201.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|