C25H38N8O6 — CID 22652036
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 22652036) has the molecular formula C25H38N8O6 and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 22652036 |
| Molecular Formula | C25H38N8O6 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C25H38N8O6/c1-13(2)20(33-21(35)16(26)7-5-9-29-25(27)28)23(37)31-18(22(36)32-19(12-34)24(38)39)10-14-11-30-17-8-4-3-6-15(14)17/h3-4,6,8,11,13,16,18-20,30,34H,5,7,9-10,12,26H2,1-2H3,(H,31,37)(H,32,36)(H,33,35)(H,38,39)(H4,27,28,29) |
| InChIKey | KKDFVVKVJQANCR-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 251.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|