C25H36N8O8 — CID 19943282
3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 19943282) has the molecular formula C25H36N8O8 and a molecular weight of 576.61 g/mol. Its IUPAC name is 3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19943282 |
| Molecular Formula | C25H36N8O8 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H36N8O8/c1-12(34)20(24(40)41)33-22(38)17(7-4-8-29-25(27)28)31-23(39)18(10-19(35)36)32-21(37)15(26)9-13-11-30-16-6-3-2-5-14(13)16/h2-3,5-6,11-12,15,17-18,20,30,34H,4,7-10,26H2,1H3,(H,31,39)(H,32,37)(H,33,38)(H,35,36)(H,40,41)(H4,27,28,29) |
| InChIKey | SHRUFRXIUOPLTL-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 288.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|