C30H40N8O7 — CID 19942822
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 19942822) has the molecular formula C30H40N8O7 and a molecular weight of 624.70 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19942822 |
| Molecular Formula | C30H40N8O7 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C30H40N8O7/c1-16(39)25(29(44)45)38-28(43)24(13-17-8-10-19(40)11-9-17)37-27(42)23(7-4-12-34-30(32)33)36-26(41)21(31)14-18-15-35-22-6-3-2-5-20(18)22/h2-3,5-6,8-11,15-16,21,23-25,35,39-40H,4,7,12-14,31H2,1H3,(H,36,41)(H,37,42)(H,38,43)(H,44,45)(H4,32,33,34) |
| InChIKey | OUVIRFVBEKUSQQ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 271.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|