C35H42N8O7 — CID 19950783
2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 19950783) has the molecular formula C35H42N8O7 and a molecular weight of 686.77 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 19950783 |
| Molecular Formula | C35H42N8O7 |
| Molecular Weight | 686.77 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C35H42N8O7/c36-26(16-20-7-11-23(44)12-8-20)31(46)41-28(6-3-15-39-35(37)38)32(47)42-29(17-21-9-13-24(45)14-10-21)33(48)43-30(34(49)50)18-22-19-40-27-5-2-1-4-25(22)27/h1-2,4-5,7-14,19,26,28-30,40,44-45H,3,6,15-18,36H2,(H,41,46)(H,42,47)(H,43,48)(H,49,50)(H4,37,38,39) |
| InChIKey | HLNARLPVJCXQRG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 271.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.77 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|