C30H38N8O8 — CID 19942809
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid (PubChem CID 19942809) has the molecular formula C30H38N8O8 and a molecular weight of 638.68 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19942809 |
| Molecular Formula | C30H38N8O8 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C30H38N8O8/c31-20(13-17-15-35-21-5-2-1-4-19(17)21)26(42)36-22(6-3-11-34-30(32)33)27(43)37-23(12-16-7-9-18(39)10-8-16)28(44)38-24(29(45)46)14-25(40)41/h1-2,4-5,7-10,15,20,22-24,35,39H,3,6,11-14,31H2,(H,36,42)(H,37,43)(H,38,44)(H,40,41)(H,45,46)(H4,32,33,34) |
| InChIKey | WYBWPOPUWSHNRG-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 288.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|