C31H41N9O7 — CID 22701326
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 22701326) has the molecular formula C31H41N9O7 and a molecular weight of 651.73 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 22701326 |
| Molecular Formula | C31H41N9O7 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C31H41N9O7/c32-21(11-12-26(33)42)27(43)38-23(6-3-13-36-31(34)35)28(44)39-24(15-18-16-37-22-5-2-1-4-20(18)22)29(45)40-25(30(46)47)14-17-7-9-19(41)10-8-17/h1-2,4-5,7-10,16,21,23-25,37,41H,3,6,11-15,32H2,(H2,33,42)(H,38,43)(H,39,44)(H,40,45)(H,46,47)(H4,34,35,36) |
| InChIKey | QACOGRGSPCSPNV-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|