C27H40N10O7 — CID 18479501
2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18479501) has the molecular formula C27H40N10O7 and a molecular weight of 616.68 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18479501 |
| Molecular Formula | C27H40N10O7 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H40N10O7/c28-16(7-9-21(29)38)23(40)35-18(8-10-22(30)39)24(41)37-20(12-14-13-34-17-5-2-1-4-15(14)17)25(42)36-19(26(43)44)6-3-11-33-27(31)32/h1-2,4-5,13,16,18-20,34H,3,6-12,28H2,(H2,29,38)(H2,30,39)(H,35,40)(H,36,42)(H,37,41)(H,43,44)(H4,31,32,33) |
| InChIKey | HCZQGZGXQBTYIV-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 316.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|