C27H39N9O8 — CID 22701313
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid (PubChem CID 22701313) has the molecular formula C27H39N9O8 and a molecular weight of 617.66 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22701313 |
| Molecular Formula | C27H39N9O8 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H39N9O8/c28-16(7-9-21(29)37)23(40)34-18(6-3-11-32-27(30)31)24(41)36-20(12-14-13-33-17-5-2-1-4-15(14)17)25(42)35-19(26(43)44)8-10-22(38)39/h1-2,4-5,13,16,18-20,33H,3,6-12,28H2,(H2,29,37)(H,34,40)(H,35,42)(H,36,41)(H,38,39)(H,43,44)(H4,30,31,32) |
| InChIKey | PYUMURWTOHSGNH-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 311.20 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|