C25H36N8O7 — CID 18262795
4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18262795) has the molecular formula C25H36N8O7 and a molecular weight of 560.61 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18262795 |
| Molecular Formula | C25H36N8O7 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H36N8O7/c1-13(31-22(37)16(26)8-9-20(34)35)21(36)33-19(11-14-12-30-17-6-3-2-5-15(14)17)23(38)32-18(24(39)40)7-4-10-29-25(27)28/h2-3,5-6,12-13,16,18-19,30H,4,7-11,26H2,1H3,(H,31,37)(H,32,38)(H,33,36)(H,34,35)(H,39,40)(H4,27,28,29) |
| InChIKey | NIZOVXGPZFNFQH-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|