C23H34N8O5S — CID 18261271
2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18261271) has the molecular formula C23H34N8O5S and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18261271 |
| Molecular Formula | C23H34N8O5S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CS)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H34N8O5S/c1-12(19(32)30-17(22(35)36)7-4-8-27-23(25)26)29-21(34)18(31-20(33)15(24)11-37)9-13-10-28-16-6-3-2-5-14(13)16/h2-3,5-6,10,12,15,17-18,28,37H,4,7-9,11,24H2,1H3,(H,29,34)(H,30,32)(H,31,33)(H,35,36)(H4,25,26,27) |
| InChIKey | JFGYCMWXSZBKCE-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|