C24H34N8O7 — CID 18253290
2-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18253290) has the molecular formula C24H34N8O7 and a molecular weight of 546.59 g/mol. Its IUPAC name is 2-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18253290 |
| Molecular Formula | C24H34N8O7 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 2-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H34N8O7/c1-12(20(35)31-17(23(38)39)7-4-8-28-24(26)27)30-22(37)18(32-21(36)15(25)10-19(33)34)9-13-11-29-16-6-3-2-5-14(13)16/h2-3,5-6,11-12,15,17-18,29H,4,7-10,25H2,1H3,(H,30,37)(H,31,35)(H,32,36)(H,33,34)(H,38,39)(H4,26,27,28) |
| InChIKey | JBTBFXABCAROIR-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 268.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|