C26H41N9O5 — CID 18302661
2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18302661) has the molecular formula C26H41N9O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18302661 |
| Molecular Formula | C26H41N9O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H41N9O5/c1-15(33-23(37)18(28)8-4-5-11-27)22(36)35-21(13-16-14-32-19-9-3-2-7-17(16)19)24(38)34-20(25(39)40)10-6-12-31-26(29)30/h2-3,7,9,14-15,18,20-21,32H,4-6,8,10-13,27-28H2,1H3,(H,33,37)(H,34,38)(H,35,36)(H,39,40)(H4,29,30,31) |
| InChIKey | JGRWZDFDHQWGET-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 256.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|