C26H41N7O5 — CID 18309054
6-amino-2-[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoic acid (PubChem CID 18309054) has the molecular formula C26H41N7O5 and a molecular weight of 531.66 g/mol. Its IUPAC name is 6-amino-2-[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18309054 |
| Molecular Formula | C26H41N7O5 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 6-amino-2-[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C26H41N7O5/c1-16(23(34)32-21(26(37)38)11-5-7-13-28)31-25(36)22(33-24(35)19(29)9-4-6-12-27)14-17-15-30-20-10-3-2-8-18(17)20/h2-3,8,10,15-16,19,21-22,30H,4-7,9,11-14,27-29H2,1H3,(H,31,36)(H,32,34)(H,33,35)(H,37,38) |
| InChIKey | LIGNKYPISVYXEK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 218.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|