C25H37N7O6 — CID 18481172
2-[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18481172) has the molecular formula C25H37N7O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18481172 |
| Molecular Formula | C25H37N7O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 2-[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(N)CCC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H37N7O6/c1-14(22(34)32-20(25(37)38)12-15-13-29-18-7-3-2-6-16(15)18)30-24(36)19(8-4-5-11-26)31-23(35)17(27)9-10-21(28)33/h2-3,6-7,13-14,17,19-20,29H,4-5,8-12,26-27H2,1H3,(H2,28,33)(H,30,36)(H,31,35)(H,32,34)(H,37,38) |
| InChIKey | LPNJKTMGJNFXMS-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|