C26H39N7O7 — CID 18483391
2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18483391) has the molecular formula C26H39N7O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18483391 |
| Molecular Formula | C26H39N7O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H39N7O7/c1-14(34)22(33-23(36)17(28)9-10-21(29)35)25(38)31-19(8-4-5-11-27)24(37)32-20(26(39)40)12-15-13-30-18-7-3-2-6-16(15)18/h2-3,6-7,13-14,17,19-20,22,30,34H,4-5,8-12,27-28H2,1H3,(H2,29,35)(H,31,38)(H,32,37)(H,33,36)(H,39,40) |
| InChIKey | DSOLLZJNAJPHMO-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 255.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|