C27H43N7O6 — CID 19946759
6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 19946759) has the molecular formula C27H43N7O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19946759 |
| Molecular Formula | C27H43N7O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C27H43N7O6/c1-16(35)23(26(38)33-22(27(39)40)11-5-7-13-29)34-25(37)21(10-4-6-12-28)32-24(36)19(30)14-17-15-31-20-9-3-2-8-18(17)20/h2-3,8-9,15-16,19,21-23,31,35H,4-7,10-14,28-30H2,1H3,(H,32,36)(H,33,38)(H,34,37)(H,39,40) |
| InChIKey | XKHFQLCGBDWAIM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 238.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|