C27H40N6O7 — CID 19944435
6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid (PubChem CID 19944435) has the molecular formula C27H40N6O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19944435 |
| Molecular Formula | C27H40N6O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C27H40N6O7/c1-15(2)23(26(38)32-21(27(39)40)9-5-6-12-28)33-25(37)20(10-11-22(34)35)31-24(36)18(29)13-16-14-30-19-8-4-3-7-17(16)19/h3-4,7-8,14-15,18,20-21,23,30H,5-6,9-13,28-29H2,1-2H3,(H,31,36)(H,32,38)(H,33,37)(H,34,35)(H,39,40) |
| InChIKey | MDVHDGNFYPDNKF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|