C25H38N6O6 — CID 18741899
2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18741899) has the molecular formula C25H38N6O6 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18741899 |
| Molecular Formula | C25H38N6O6 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H38N6O6/c1-14(2)21(31-23(34)19(9-5-6-10-26)29-22(33)17(27)13-32)24(35)30-20(25(36)37)11-15-12-28-18-8-4-3-7-16(15)18/h3-4,7-8,12,14,17,19-21,28,32H,5-6,9-11,13,26-27H2,1-2H3,(H,29,33)(H,30,35)(H,31,34)(H,36,37) |
| InChIKey | ZZYUFYBWLVLUFI-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|