C26H38N6O7 — CID 19946811
2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid (PubChem CID 19946811) has the molecular formula C26H38N6O7 and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19946811 |
| Molecular Formula | C26H38N6O7 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H38N6O7/c1-14(2)22(25(37)31-20(26(38)39)12-21(33)34)32-24(36)19(9-5-6-10-27)30-23(35)17(28)11-15-13-29-18-8-4-3-7-16(15)18/h3-4,7-8,13-14,17,19-20,22,29H,5-6,9-12,27-28H2,1-2H3,(H,30,35)(H,31,37)(H,32,36)(H,33,34)(H,38,39) |
| InChIKey | PARMURIUMSXMHO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|