C28H40N8O5 — CID 19949849
2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 19949849) has the molecular formula C28H40N8O5 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 19949849 |
| Molecular Formula | C28H40N8O5 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C28H40N8O5/c1-16(2)24(36-25(37)20(30)11-17-13-32-21-8-4-3-7-19(17)21)27(39)34-22(9-5-6-10-29)26(38)35-23(28(40)41)12-18-14-31-15-33-18/h3-4,7-8,13-16,20,22-24,32H,5-6,9-12,29-30H2,1-2H3,(H,31,33)(H,34,39)(H,35,38)(H,36,37)(H,40,41) |
| InChIKey | TWUORHYFYXTGNL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 221.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|