C26H36N8O6 — CID 19946736
2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 19946736) has the molecular formula C26H36N8O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 19946736 |
| Molecular Formula | C26H36N8O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H36N8O6/c27-8-4-3-7-20(32-23(36)18(28)9-15-11-30-19-6-2-1-5-17(15)19)24(37)34-22(13-35)25(38)33-21(26(39)40)10-16-12-29-14-31-16/h1-2,5-6,11-12,14,18,20-22,30,35H,3-4,7-10,13,27-28H2,(H,29,31)(H,32,36)(H,33,38)(H,34,37)(H,39,40) |
| InChIKey | JWPZHOHWKFRUQI-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 241.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|