C20H29N5O5 — CID 145458436
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 145458436) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 145458436 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C20H29N5O5/c21-8-4-3-7-16(19(28)25-17(11-26)20(29)30)24-18(27)14(22)9-12-10-23-15-6-2-1-5-13(12)15/h1-2,5-6,10,14,16-17,23,26H,3-4,7-9,11,21-22H2,(H,24,27)(H,25,28)(H,29,30)/t14-,16-,17-/m0/s1 |
| InChIKey | ULHASJWZGUEUNN-XIRDDKMYSA-N |
| XLogP | -0.79 |
| TPSA | 183.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|