C25H34N6O9 — CID 19943317
6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid (PubChem CID 19943317) has the molecular formula C25H34N6O9 and a molecular weight of 562.58 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19943317 |
| Molecular Formula | C25H34N6O9 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H34N6O9/c26-8-4-3-7-17(25(39)40)29-23(37)19(11-21(34)35)31-24(38)18(10-20(32)33)30-22(36)15(27)9-13-12-28-16-6-2-1-5-14(13)16/h1-2,5-6,12,15,17-19,28H,3-4,7-11,26-27H2,(H,29,37)(H,30,36)(H,31,38)(H,32,33)(H,34,35)(H,39,40) |
| InChIKey | OLACSEPLEFDIKP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 267.03 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|