C26H37N7O8 — CID 19942957
6-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 19942957) has the molecular formula C26H37N7O8 and a molecular weight of 575.62 g/mol. Its IUPAC name is 6-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19942957 |
| Molecular Formula | C26H37N7O8 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 6-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H37N7O8/c27-10-4-3-7-19(26(40)41)32-24(38)18(8-9-22(35)36)31-25(39)20(12-21(29)34)33-23(37)16(28)11-14-13-30-17-6-2-1-5-15(14)17/h1-2,5-6,13,16,18-20,30H,3-4,7-12,27-28H2,(H2,29,34)(H,31,39)(H,32,38)(H,33,37)(H,35,36)(H,40,41) |
| InChIKey | FFCFOBAKISMAMP-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 272.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|