C27H40N8O7 — CID 19946560
5-amino-2-[[5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid (PubChem CID 19946560) has the molecular formula C27H40N8O7 and a molecular weight of 588.67 g/mol. Its IUPAC name is 5-amino-2-[[5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19946560 |
| Molecular Formula | C27H40N8O7 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 5-amino-2-[[5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C27H40N8O7/c28-12-4-3-7-19(33-24(38)17(29)13-15-14-32-18-6-2-1-5-16(15)18)25(39)34-20(8-10-22(30)36)26(40)35-21(27(41)42)9-11-23(31)37/h1-2,5-6,14,17,19-21,32H,3-4,7-13,28-29H2,(H2,30,36)(H2,31,37)(H,33,38)(H,34,39)(H,35,40)(H,41,42) |
| InChIKey | LRUNTTQMMWOOFH-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 278.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|