C27H41N7O7 — CID 19943477
6-amino-2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]hexanoyl]amino]hexanoic acid (PubChem CID 19943477) has the molecular formula C27H41N7O7 and a molecular weight of 575.67 g/mol. Its IUPAC name is 6-amino-2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]hexanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19943477 |
| Molecular Formula | C27H41N7O7 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 6-amino-2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-carboxypropanoyl]amino]hexanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCCN)NC(=O)C(CC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H41N7O7/c28-11-5-3-9-20(25(38)33-21(27(40)41)10-4-6-12-29)32-26(39)22(14-23(35)36)34-24(37)18(30)13-16-15-31-19-8-2-1-7-17(16)19/h1-2,7-8,15,18,20-22,31H,3-6,9-14,28-30H2,(H,32,39)(H,33,38)(H,34,37)(H,35,36)(H,40,41) |
| InChIKey | JCPNJENBHLAGBZ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 255.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|