C24H34N6O7 — CID 19942275
2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]butanedioic acid (PubChem CID 19942275) has the molecular formula C24H34N6O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19942275 |
| Molecular Formula | C24H34N6O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]butanedioic acid |
| SMILES | CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H34N6O7/c1-13(28-22(34)16(26)10-14-12-27-17-7-3-2-6-15(14)17)21(33)29-18(8-4-5-9-25)23(35)30-19(24(36)37)11-20(31)32/h2-3,6-7,12-13,16,18-19,27H,4-5,8-11,25-26H2,1H3,(H,28,34)(H,29,33)(H,30,35)(H,31,32)(H,36,37) |
| InChIKey | WBHFZNGRBRXDTI-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|