C26H40N6O5 — CID 19946256
2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 19946256) has the molecular formula C26H40N6O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19946256 |
| Molecular Formula | C26H40N6O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C26H40N6O5/c1-15(2)12-22(25(35)31-21(10-6-7-11-27)24(34)30-16(3)26(36)37)32-23(33)19(28)13-17-14-29-20-9-5-4-8-18(17)20/h4-5,8-9,14-16,19,21-22,29H,6-7,10-13,27-28H2,1-3H3,(H,30,34)(H,31,35)(H,32,33)(H,36,37) |
| InChIKey | NMHYMBLRERJMHC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|