C23H35N5O4 — CID 145458418
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 145458418) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145458418 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C23H35N5O4/c1-14(2)11-20(22(30)27-19(23(31)32)9-5-6-10-24)28-21(29)17(25)12-15-13-26-18-8-4-3-7-16(15)18/h3-4,7-8,13-14,17,19-20,26H,5-6,9-12,24-25H2,1-2H3,(H,27,30)(H,28,29)(H,31,32)/t17-,19-,20-/m0/s1 |
| InChIKey | RRVUOLRWIZXBRQ-IHPCNDPISA-N |
| XLogP | 1.27 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|