C27H38N6O9 — CID 19944157
6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 19944157) has the molecular formula C27H38N6O9 and a molecular weight of 590.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19944157 |
| Molecular Formula | C27H38N6O9 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H38N6O9/c28-12-4-3-7-21(27(41)42)33-26(40)20(9-11-23(36)37)32-25(39)19(8-10-22(34)35)31-24(38)17(29)13-15-14-30-18-6-2-1-5-16(15)18/h1-2,5-6,14,17,19-21,30H,3-4,7-13,28-29H2,(H,31,38)(H,32,39)(H,33,40)(H,34,35)(H,36,37)(H,41,42) |
| InChIKey | UZAPUMYQMODPKJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 267.03 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|