C22H32N6O5 — CID 18231680
5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 18231680) has the molecular formula C22H32N6O5 and a molecular weight of 460.54 g/mol. Its IUPAC name is 5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18231680 |
| Molecular Formula | C22H32N6O5 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 5-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H32N6O5/c23-10-4-3-7-17(21(31)28-18(22(32)33)8-9-19(25)29)27-20(30)15(24)11-13-12-26-16-6-2-1-5-14(13)16/h1-2,5-6,12,15,17-18,26H,3-4,7-11,23-24H2,(H2,25,29)(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | UPNRACRNHISCAF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 206.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|