C27H39N7O8 — CID 18483779
2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 18483779) has the molecular formula C27H39N7O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18483779 |
| Molecular Formula | C27H39N7O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(N)=O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H39N7O8/c28-12-4-3-7-19(25(39)33-20(27(41)42)9-11-23(36)37)32-26(40)21(34-24(38)17(29)8-10-22(30)35)13-15-14-31-18-6-2-1-5-16(15)18/h1-2,5-6,14,17,19-21,31H,3-4,7-13,28-29H2,(H2,30,35)(H,32,40)(H,33,39)(H,34,38)(H,36,37)(H,41,42) |
| InChIKey | QVOYCUNVIYDCHB-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 272.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|