C31H41N7O6 — CID 18482305
6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 18482305) has the molecular formula C31H41N7O6 and a molecular weight of 607.71 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18482305 |
| Molecular Formula | C31H41N7O6 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C31H41N7O6/c32-15-7-6-12-24(31(43)44)36-30(42)26(17-20-18-35-23-11-5-4-10-21(20)23)38-29(41)25(16-19-8-2-1-3-9-19)37-28(40)22(33)13-14-27(34)39/h1-5,8-11,18,22,24-26,35H,6-7,12-17,32-33H2,(H2,34,39)(H,36,42)(H,37,40)(H,38,41)(H,43,44) |
| InChIKey | JJHFNSIPGWZQOI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|