C28H43N7O7 — CID 22697335
6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 22697335) has the molecular formula C28H43N7O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22697335 |
| Molecular Formula | C28H43N7O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCCN)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H43N7O7/c29-13-5-3-9-21(33-25(38)19(31)11-12-24(36)37)26(39)35-23(15-17-16-32-20-8-2-1-7-18(17)20)27(40)34-22(28(41)42)10-4-6-14-30/h1-2,7-8,16,19,21-23,32H,3-6,9-15,29-31H2,(H,33,38)(H,34,40)(H,35,39)(H,36,37)(H,41,42) |
| InChIKey | USVOHOWFMVVEHN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 255.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|