C25H36N6O7S — CID 18304243
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid (PubChem CID 18304243) has the molecular formula C25H36N6O7S and a molecular weight of 564.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18304243 |
| Molecular Formula | C25H36N6O7S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H36N6O7S/c26-10-4-3-6-16(27)22(34)31-20(13-39)24(36)30-19(11-14-12-28-17-7-2-1-5-15(14)17)23(35)29-18(25(37)38)8-9-21(32)33/h1-2,5,7,12,16,18-20,28,39H,3-4,6,8-11,13,26-27H2,(H,29,35)(H,30,36)(H,31,34)(H,32,33)(H,37,38) |
| InChIKey | MANRVWFAJDKXDI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|