C24H31N5O9S — CID 18264392
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid (PubChem CID 18264392) has the molecular formula C24H31N5O9S and a molecular weight of 565.61 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18264392 |
| Molecular Formula | C24H31N5O9S |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(CCC(=O)O)C(=O)NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H31N5O9S/c25-14(5-7-19(30)31)21(34)29-18(11-39)23(36)28-17(9-12-10-26-15-4-2-1-3-13(12)15)22(35)27-16(24(37)38)6-8-20(32)33/h1-4,10,14,16-18,26,39H,5-9,11,25H2,(H,27,35)(H,28,36)(H,29,34)(H,30,31)(H,32,33)(H,37,38) |
| InChIKey | LLNLPXGJSLEVCT-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|