C24H29N5O11 — CID 18263727
4-amino-5-[[3-carboxy-1-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18263727) has the molecular formula C24H29N5O11 and a molecular weight of 563.52 g/mol. Its IUPAC name is 4-amino-5-[[3-carboxy-1-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[3-carboxy-1-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18263727 |
| Molecular Formula | C24H29N5O11 |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 4-amino-5-[[3-carboxy-1-[[3-carboxy-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H29N5O11/c25-13(5-6-18(30)31)21(36)27-15(8-19(32)33)22(37)28-16(9-20(34)35)23(38)29-17(24(39)40)7-11-10-26-14-4-2-1-3-12(11)14/h1-4,10,13,15-17,26H,5-9,25H2,(H,27,36)(H,28,37)(H,29,38)(H,30,31)(H,32,33)(H,34,35)(H,39,40) |
| InChIKey | WSQFPIBGLHXGHI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 278.31 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |