C16H19N3Na2O5 — CID 131876423
CID 131876423 (PubChem CID 131876423) has the molecular formula C16H19N3Na2O5 and a molecular weight of 379.32 g/mol.
| Compound Name | CID 131876423 |
|---|---|
| PubChem CID | 131876423 |
| Molecular Formula | C16H19N3Na2O5 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | — |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.[Na].[Na] |
| InChI | InChI=1S/C16H19N3O5.2Na/c17-11(5-6-14(20)21)15(22)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12;;/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24);;/t11-,13-;;/m0../s1 |
| InChIKey | PHUDACCVRSFBHN-JBUFHSOLSA-N |
| XLogP | -0.29 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |