C16H18N3NaO5 — CID 142770271
sodium (2S)-2-[[(2R)-2-amino-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 142770271) has the molecular formula C16H18N3NaO5 and a molecular weight of 355.33 g/mol. Its IUPAC name is sodium (2S)-2-[[(2R)-2-amino-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | sodium (2S)-2-[[(2R)-2-amino-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 142770271 |
| Molecular Formula | C16H18N3NaO5 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | sodium (2S)-2-[[(2R)-2-amino-4-carboxybutanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | N[C@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H19N3O5.Na/c17-11(5-6-14(20)21)15(22)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12;/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24);/q;+1/p-1/t11-,13+;/m1./s1 |
| InChIKey | PPOXPZSKKYHJRX-YLAFAASESA-M |
| XLogP | -3.86 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |