C22H29N5O8S — CID 18261574
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 18261574) has the molecular formula C22H29N5O8S and a molecular weight of 523.57 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18261574 |
| Molecular Formula | C22H29N5O8S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H29N5O8S/c23-13(10-36)19(31)26-16(7-11-8-24-14-4-2-1-3-12(11)14)20(32)27-17(9-28)21(33)25-15(22(34)35)5-6-18(29)30/h1-4,8,13,15-17,24,28,36H,5-7,9-10,23H2,(H,25,33)(H,26,31)(H,27,32)(H,29,30)(H,34,35) |
| InChIKey | AAUNICLSSGMYHZ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|